C29H34N4O7S2 — CID 4265009
N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-4-methyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 4265009) has the molecular formula C29H34N4O7S2 and a molecular weight of 614.75 g/mol. Its IUPAC name is N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-4-methyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-4-methyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4265009 |
| Molecular Formula | C29H34N4O7S2 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-4-methyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)c3ccc(C)c(S(=O)(=O)N4CCOCC4)c3)ccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C29H34N4O7S2/c1-21-5-6-22(19-27(21)42(37,38)33-15-17-40-18-16-33)29(34)30-24-9-12-26(32-13-3-4-14-32)28(20-24)41(35,36)31-23-7-10-25(39-2)11-8-23/h5-12,19-20,31H,3-4,13-18H2,1-2H3,(H,30,34) |
| InChIKey | PWXPZDUSENSITN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|