C24H23F2N3O4S — CID 4021155
3,5-difluoro-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]benzamide (PubChem CID 4021155) has the molecular formula C24H23F2N3O4S and a molecular weight of 487.53 g/mol. Its IUPAC name is 3,5-difluoro-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]benzamide.
| Compound Name | 3,5-difluoro-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]benzamide |
|---|---|
| PubChem CID | 4021155 |
| Molecular Formula | C24H23F2N3O4S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 3,5-difluoro-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)c3cc(F)cc(F)c3)ccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C24H23F2N3O4S/c1-33-21-7-4-19(5-8-21)28-34(31,32)23-15-20(6-9-22(23)29-10-2-3-11-29)27-24(30)16-12-17(25)14-18(26)13-16/h4-9,12-15,28H,2-3,10-11H2,1H3,(H,27,30) |
| InChIKey | BNFHYJBEFVVDRI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|