C27H35N3O4S — CID 25339777
2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-piperidin-1-ylphenyl]acetamide (PubChem CID 25339777) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-piperidin-1-ylphenyl]acetamide.
| Compound Name | 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-piperidin-1-ylphenyl]acetamide |
|---|---|
| PubChem CID | 25339777 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-piperidin-1-ylphenyl]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)C[C@@H]3C[C@H]4CC[C@@H]3C4)ccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C27H35N3O4S/c1-34-24-10-7-22(8-11-24)29-35(32,33)26-18-23(9-12-25(26)30-13-3-2-4-14-30)28-27(31)17-21-16-19-5-6-20(21)15-19/h7-12,18-21,29H,2-6,13-17H2,1H3,(H,28,31)/t19-,20+,21-/m0/s1 |
| InChIKey | FTDNBAPYDSAPNP-HBMCJLEFSA-N |
| XLogP | 5.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|