C25H32N4O3S2 — CID 26058706
1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]thiourea (PubChem CID 26058706) has the molecular formula C25H32N4O3S2 and a molecular weight of 500.69 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]thiourea.
| Compound Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]thiourea |
|---|---|
| PubChem CID | 26058706 |
| Molecular Formula | C25H32N4O3S2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]thiourea |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=S)N[C@@H]3C[C@H]4CC[C@@H]3C4)ccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C25H32N4O3S2/c1-32-21-9-6-19(7-10-21)28-34(30,31)24-16-20(8-11-23(24)29-12-2-3-13-29)26-25(33)27-22-15-17-4-5-18(22)14-17/h6-11,16-18,22,28H,2-5,12-15H2,1H3,(H2,26,27,33)/t17-,18+,22+/m0/s1 |
| InChIKey | YWUINEOAZLVAQG-NJNPRVFISA-N |
| XLogP | 4.57 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|