C16H22ClN3O2S2 — CID 18557302
1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[4-chloro-3-(dimethylsulfamoyl)phenyl]thiourea (PubChem CID 18557302) has the molecular formula C16H22ClN3O2S2 and a molecular weight of 387.96 g/mol. Its IUPAC name is 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[4-chloro-3-(dimethylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[4-chloro-3-(dimethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 18557302 |
| Molecular Formula | C16H22ClN3O2S2 |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[4-chloro-3-(dimethylsulfamoyl)phenyl]thiourea |
| SMILES | CN(C)S(=O)(=O)c1cc(NC(=S)N[C@H]2C[C@@H]3CC[C@@H]2C3)ccc1Cl |
| InChI | InChI=1S/C16H22ClN3O2S2/c1-20(2)24(21,22)15-9-12(5-6-13(15)17)18-16(23)19-14-8-10-3-4-11(14)7-10/h5-6,9-11,14H,3-4,7-8H2,1-2H3,(H2,18,19,23)/t10-,11-,14+/m1/s1 |
| InChIKey | YWNMGKBSTVSWBN-GYSYKLTISA-N |
| XLogP | 3.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|