C16H22N2O2S2 — CID 98786916
1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[4-(methylsulfonylmethyl)phenyl]thiourea (PubChem CID 98786916) has the molecular formula C16H22N2O2S2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[4-(methylsulfonylmethyl)phenyl]thiourea.
| Compound Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[4-(methylsulfonylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 98786916 |
| Molecular Formula | C16H22N2O2S2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[4-(methylsulfonylmethyl)phenyl]thiourea |
| SMILES | CS(=O)(=O)Cc1ccc(NC(=S)N[C@@H]2C[C@H]3CC[C@H]2C3)cc1 |
| InChI | InChI=1S/C16H22N2O2S2/c1-22(19,20)10-11-3-6-14(7-4-11)17-16(21)18-15-9-12-2-5-13(15)8-12/h3-4,6-7,12-13,15H,2,5,8-10H2,1H3,(H2,17,18,21)/t12-,13-,15+/m0/s1 |
| InChIKey | NWHZZOXZMKPWNL-KCQAQPDRSA-N |
| XLogP | 2.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|