C20H23N3S — CID 11919127
1-(4-anilinophenyl)-3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]thiourea (PubChem CID 11919127) has the molecular formula C20H23N3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-(4-anilinophenyl)-3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]thiourea.
| Compound Name | 1-(4-anilinophenyl)-3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]thiourea |
|---|---|
| PubChem CID | 11919127 |
| Molecular Formula | C20H23N3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-(4-anilinophenyl)-3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]thiourea |
| SMILES | S=C(Nc1ccc(Nc2ccccc2)cc1)N[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C20H23N3S/c24-20(23-19-13-14-6-7-15(19)12-14)22-18-10-8-17(9-11-18)21-16-4-2-1-3-5-16/h1-5,8-11,14-15,19,21H,6-7,12-13H2,(H2,22,23,24)/t14-,15+,19+/m0/s1 |
| InChIKey | GYWCQSCDXAJPMR-QMTMVMCOSA-N |
| XLogP | 4.91 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|