C13H17N3S — CID 125044957
1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-pyridin-4-ylthiourea (PubChem CID 125044957) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-pyridin-4-ylthiourea.
| Compound Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-pyridin-4-ylthiourea |
|---|---|
| PubChem CID | 125044957 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-pyridin-4-ylthiourea |
| SMILES | S=C(Nc1ccncc1)N[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C13H17N3S/c17-13(15-11-3-5-14-6-4-11)16-12-8-9-1-2-10(12)7-9/h3-6,9-10,12H,1-2,7-8H2,(H2,14,15,16,17)/t9-,10-,12+/m0/s1 |
| InChIKey | XWNMYFCNWPYUGI-JBLDHEPKSA-N |
| XLogP | 2.56 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|