C13H18N4S — CID 10400491
1-(6-amino-3-pyridinyl)-3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]thiourea (PubChem CID 10400491) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is 1-(6-amino-3-pyridinyl)-3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]thiourea.
| Compound Name | 1-(6-amino-3-pyridinyl)-3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]thiourea |
|---|---|
| PubChem CID | 10400491 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-(6-amino-3-pyridinyl)-3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]thiourea |
| SMILES | Nc1ccc(NC(=S)N[C@@H]2C[C@H]3CC[C@@H]2C3)cn1 |
| InChI | InChI=1S/C13H18N4S/c14-12-4-3-10(7-15-12)16-13(18)17-11-6-8-1-2-9(11)5-8/h3-4,7-9,11H,1-2,5-6H2,(H2,14,15)(H2,16,17,18)/t8-,9+,11+/m0/s1 |
| InChIKey | OHXXJCYWNSZXLP-IQJOONFLSA-N |
| XLogP | 2.14 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|