C15H19BrN2S — CID 11919242
1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(4-bromo-3-methylphenyl)thiourea (PubChem CID 11919242) has the molecular formula C15H19BrN2S and a molecular weight of 339.30 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(4-bromo-3-methylphenyl)thiourea.
| Compound Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(4-bromo-3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 11919242 |
| Molecular Formula | C15H19BrN2S |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-(4-bromo-3-methylphenyl)thiourea |
| SMILES | Cc1cc(NC(=S)N[C@@H]2C[C@H]3CC[C@@H]2C3)ccc1Br |
| InChI | InChI=1S/C15H19BrN2S/c1-9-6-12(4-5-13(9)16)17-15(19)18-14-8-10-2-3-11(14)7-10/h4-6,10-11,14H,2-3,7-8H2,1H3,(H2,17,18,19)/t10-,11+,14+/m0/s1 |
| InChIKey | IVDFAQJGBZGLFB-MISXGVKJSA-N |
| XLogP | 4.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|