C16H22N2S — CID 100592921
1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-(2,4-dimethylphenyl)thiourea (PubChem CID 100592921) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 100592921 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-(2,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N[C@H]2C[C@@H]3CC[C@@H]2C3)c(C)c1 |
| InChI | InChI=1S/C16H22N2S/c1-10-3-6-14(11(2)7-10)17-16(19)18-15-9-12-4-5-13(15)8-12/h3,6-7,12-13,15H,4-5,8-9H2,1-2H3,(H2,17,18,19)/t12-,13-,15+/m1/s1 |
| InChIKey | QBWSOONDISHYIE-NFAWXSAZSA-N |
| XLogP | 3.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|