C30H38N4O2S2 — CID 21456074
1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-[4-[4-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]carbamothioylamino]-3-methoxyphenyl]-2-methoxyphenyl]thiourea (PubChem CID 21456074) has the molecular formula C30H38N4O2S2 and a molecular weight of 550.79 g/mol. Its IUPAC name is 1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-[4-[4-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]carbamothioylamino]-3-methoxyphenyl]-2-methoxyphenyl]thiourea.
| Compound Name | 1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-[4-[4-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]carbamothioylamino]-3-methoxyphenyl]-2-methoxyphenyl]thiourea |
|---|---|
| PubChem CID | 21456074 |
| Molecular Formula | C30H38N4O2S2 |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-[4-[4-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]carbamothioylamino]-3-methoxyphenyl]-2-methoxyphenyl]thiourea |
| SMILES | COc1cc(-c2ccc(NC(=S)N[C@@H]3C[C@@H]4CC[C@@H]3C4)c(OC)c2)ccc1NC(=S)N[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C30H38N4O2S2/c1-35-27-15-19(7-9-23(27)31-29(37)33-25-13-17-3-5-21(25)11-17)20-8-10-24(28(16-20)36-2)32-30(38)34-26-14-18-4-6-22(26)12-18/h7-10,15-18,21-22,25-26H,3-6,11-14H2,1-2H3,(H2,31,33,37)(H2,32,34,38)/t17-,18-,21-,22-,25-,26-/m1/s1 |
| InChIKey | AFWNBFVUVZDZGH-NOYLXZRQSA-N |
| XLogP | 6.32 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|