C15H20N2OS — CID 11919190
1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(3-methoxyphenyl)thiourea (PubChem CID 11919190) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 11919190 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)N[C@H]2C[C@H]3CC[C@@H]2C3)c1 |
| InChI | InChI=1S/C15H20N2OS/c1-18-13-4-2-3-12(9-13)16-15(19)17-14-8-10-5-6-11(14)7-10/h2-4,9-11,14H,5-8H2,1H3,(H2,16,17,19)/t10-,11+,14-/m0/s1 |
| InChIKey | JAFCEAOLPUWURX-WDMOLILDSA-N |
| XLogP | 3.17 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|