C16H22N2OS — CID 100593582
1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-(3-ethoxyphenyl)thiourea (PubChem CID 100593582) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-(3-ethoxyphenyl)thiourea.
| Compound Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-(3-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100593582 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-(3-ethoxyphenyl)thiourea |
| SMILES | CCOc1cccc(NC(=S)N[C@H]2C[C@@H]3CC[C@@H]2C3)c1 |
| InChI | InChI=1S/C16H22N2OS/c1-2-19-14-5-3-4-13(10-14)17-16(20)18-15-9-11-6-7-12(15)8-11/h3-5,10-12,15H,2,6-9H2,1H3,(H2,17,18,20)/t11-,12-,15+/m1/s1 |
| InChIKey | KPHHIKZKAGKNGZ-JMSVASOKSA-N |
| XLogP | 3.56 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|