C18H27N3O2S2 — CID 7939340
1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[3-(diethylsulfamoyl)phenyl]thiourea (PubChem CID 7939340) has the molecular formula C18H27N3O2S2 and a molecular weight of 381.57 g/mol. Its IUPAC name is 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[3-(diethylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[3-(diethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 7939340 |
| Molecular Formula | C18H27N3O2S2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[3-(diethylsulfamoyl)phenyl]thiourea |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=S)N[C@@H]2C[C@H]3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C18H27N3O2S2/c1-3-21(4-2)25(22,23)16-7-5-6-15(12-16)19-18(24)20-17-11-13-8-9-14(17)10-13/h5-7,12-14,17H,3-4,8-11H2,1-2H3,(H2,19,20,24)/t13-,14-,17+/m0/s1 |
| InChIKey | NZKRQODVXWPTJF-GRDNDAEWSA-N |
| XLogP | 3.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|