C16H21ClN2O2S — CID 18557199
1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(4-chloro-2,5-dimethoxyphenyl)thiourea (PubChem CID 18557199) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is 1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(4-chloro-2,5-dimethoxyphenyl)thiourea.
| Compound Name | 1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(4-chloro-2,5-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 18557199 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(4-chloro-2,5-dimethoxyphenyl)thiourea |
| SMILES | COc1cc(NC(=S)N[C@@H]2C[C@@H]3CC[C@@H]2C3)c(OC)cc1Cl |
| InChI | InChI=1S/C16H21ClN2O2S/c1-20-14-8-13(15(21-2)7-11(14)17)19-16(22)18-12-6-9-3-4-10(12)5-9/h7-10,12H,3-6H2,1-2H3,(H2,18,19,22)/t9-,10-,12-/m1/s1 |
| InChIKey | FZTKIEWUYBQEPA-CKYFFXLPSA-N |
| XLogP | 3.83 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|