C16H23ClN2O2S — CID 8787495
1-(4-chloro-2,5-dimethoxyphenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea (PubChem CID 8787495) has the molecular formula C16H23ClN2O2S and a molecular weight of 342.89 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8787495 |
| Molecular Formula | C16H23ClN2O2S |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
| SMILES | COc1cc(NC(=S)N[C@@H]2CCCC[C@@H]2C)c(OC)cc1Cl |
| InChI | InChI=1S/C16H23ClN2O2S/c1-10-6-4-5-7-12(10)18-16(22)19-13-9-14(20-2)11(17)8-15(13)21-3/h8-10,12H,4-7H2,1-3H3,(H2,18,19,22)/t10-,12+/m0/s1 |
| InChIKey | AWYZWDOSLBYUNO-CMPLNLGQSA-N |
| XLogP | 4.22 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|