C17H25ClN2O3 — CID 46797821
2-(4-chloro-2,5-dimethoxyanilino)-N-(2-methylcyclohexyl)acetamide (PubChem CID 46797821) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is 2-(4-chloro-2,5-dimethoxyanilino)-N-(2-methylcyclohexyl)acetamide.
| Compound Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-(2-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 46797821 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-(2-methylcyclohexyl)acetamide |
| SMILES | COc1cc(NCC(=O)NC2CCCCC2C)c(OC)cc1Cl |
| InChI | InChI=1S/C17H25ClN2O3/c1-11-6-4-5-7-13(11)20-17(21)10-19-14-9-15(22-2)12(18)8-16(14)23-3/h8-9,11,13,19H,4-7,10H2,1-3H3,(H,20,21) |
| InChIKey | XWPGIUKWFJHEAL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |