C18H28N2O4 — CID 78808028
N-(2-methylcyclohexyl)-2-(3,4,5-trimethoxyanilino)acetamide (PubChem CID 78808028) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-2-(3,4,5-trimethoxyanilino)acetamide.
| Compound Name | N-(2-methylcyclohexyl)-2-(3,4,5-trimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 78808028 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-(2-methylcyclohexyl)-2-(3,4,5-trimethoxyanilino)acetamide |
| SMILES | COc1cc(NCC(=O)NC2CCCCC2C)cc(OC)c1OC |
| InChI | InChI=1S/C18H28N2O4/c1-12-7-5-6-8-14(12)20-17(21)11-19-13-9-15(22-2)18(24-4)16(10-13)23-3/h9-10,12,14,19H,5-8,11H2,1-4H3,(H,20,21) |
| InChIKey | FEUSYWGVXVMDLE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|