C18H27NO4 — CID 9084467
N-[(1R,2S)-2-methylcyclohexyl]-2-(2,3,4-trimethoxyphenyl)acetamide (PubChem CID 9084467) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[(1R,2S)-2-methylcyclohexyl]-2-(2,3,4-trimethoxyphenyl)acetamide.
| Compound Name | N-[(1R,2S)-2-methylcyclohexyl]-2-(2,3,4-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9084467 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-[(1R,2S)-2-methylcyclohexyl]-2-(2,3,4-trimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N[C@@H]2CCCC[C@@H]2C)c(OC)c1OC |
| InChI | InChI=1S/C18H27NO4/c1-12-7-5-6-8-14(12)19-16(20)11-13-9-10-15(21-2)18(23-4)17(13)22-3/h9-10,12,14H,5-8,11H2,1-4H3,(H,19,20)/t12-,14+/m0/s1 |
| InChIKey | LJHCPCQKERIPPW-GXTWGEPZSA-N |
| XLogP | 2.95 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |