C14H19ClN2O5S — CID 109001805
2-(4-chloro-2,5-dimethoxyanilino)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 109001805) has the molecular formula C14H19ClN2O5S and a molecular weight of 362.84 g/mol. Its IUPAC name is 2-(4-chloro-2,5-dimethoxyanilino)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 109001805 |
| Molecular Formula | C14H19ClN2O5S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | COc1cc(NCC(=O)NC2CCS(=O)(=O)C2)c(OC)cc1Cl |
| InChI | InChI=1S/C14H19ClN2O5S/c1-21-12-6-11(13(22-2)5-10(12)15)16-7-14(18)17-9-3-4-23(19,20)8-9/h5-6,9,16H,3-4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | WQFPBLACRSLCFU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |