C19H29N3O6S2 — CID 55364871
2-[5-(azepan-1-ylsulfonyl)-2-methoxyanilino]-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 55364871) has the molecular formula C19H29N3O6S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 2-[5-(azepan-1-ylsulfonyl)-2-methoxyanilino]-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-[5-(azepan-1-ylsulfonyl)-2-methoxyanilino]-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 55364871 |
| Molecular Formula | C19H29N3O6S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-[5-(azepan-1-ylsulfonyl)-2-methoxyanilino]-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCCC2)cc1NCC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H29N3O6S2/c1-28-18-7-6-16(30(26,27)22-9-4-2-3-5-10-22)12-17(18)20-13-19(23)21-15-8-11-29(24,25)14-15/h6-7,12,15,20H,2-5,8-11,13-14H2,1H3,(H,21,23) |
| InChIKey | FLLOKCXDLSQJEK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |