C20H31N3O5S — CID 55478397
2-[5-(azepan-1-ylsulfonyl)-2-methoxyanilino]-1-(2-methylmorpholin-4-yl)ethanone (PubChem CID 55478397) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-[5-(azepan-1-ylsulfonyl)-2-methoxyanilino]-1-(2-methylmorpholin-4-yl)ethanone.
| Compound Name | 2-[5-(azepan-1-ylsulfonyl)-2-methoxyanilino]-1-(2-methylmorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 55478397 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-[5-(azepan-1-ylsulfonyl)-2-methoxyanilino]-1-(2-methylmorpholin-4-yl)ethanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCCC2)cc1NCC(=O)N1CCOC(C)C1 |
| InChI | InChI=1S/C20H31N3O5S/c1-16-15-22(11-12-28-16)20(24)14-21-18-13-17(7-8-19(18)27-2)29(25,26)23-9-5-3-4-6-10-23/h7-8,13,16,21H,3-6,9-12,14-15H2,1-2H3 |
| InChIKey | ZPHNMLASOWWBAL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |