C19H29N3O3S2 — CID 4846327
1-cyclohexyl-3-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)thiourea (PubChem CID 4846327) has the molecular formula C19H29N3O3S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-cyclohexyl-3-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 4846327 |
| Molecular Formula | C19H29N3O3S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-cyclohexyl-3-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)thiourea |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C19H29N3O3S2/c1-25-18-11-10-16(27(23,24)22-12-6-3-7-13-22)14-17(18)21-19(26)20-15-8-4-2-5-9-15/h10-11,14-15H,2-9,12-13H2,1H3,(H2,20,21,26) |
| InChIKey | AETZLPXUKRXVAF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|