C16H25N3O4S2 — CID 100567287
1-(3-methoxypropyl)-3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)thiourea (PubChem CID 100567287) has the molecular formula C16H25N3O4S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(3-methoxypropyl)-3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 100567287 |
| Molecular Formula | C16H25N3O4S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-(3-methoxypropyl)-3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)thiourea |
| SMILES | COCCCNC(=S)Nc1cc(S(=O)(=O)N2CCCC2)ccc1OC |
| InChI | InChI=1S/C16H25N3O4S2/c1-22-11-5-8-17-16(24)18-14-12-13(6-7-15(14)23-2)25(20,21)19-9-3-4-10-19/h6-7,12H,3-5,8-11H2,1-2H3,(H2,17,18,24) |
| InChIKey | ZBWBYOBNTOJOJB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|