C17H25N3O4S2 — CID 100567444
1-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 100567444) has the molecular formula C17H25N3O4S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100567444 |
| Molecular Formula | C17H25N3O4S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1NC(=S)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C17H25N3O4S2/c1-23-16-7-6-14(26(21,22)20-8-2-3-9-20)11-15(16)19-17(25)18-12-13-5-4-10-24-13/h6-7,11,13H,2-5,8-10,12H2,1H3,(H2,18,19,25)/t13-/m1/s1 |
| InChIKey | OVNQTKJJVJOSFD-CYBMUJFWSA-N |
| XLogP | 1.95 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|