C24H30N2O6S — CID 24633586
N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-3-(oxolan-2-ylmethoxy)benzamide (PubChem CID 24633586) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-3-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-3-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 24633586 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-3-(oxolan-2-ylmethoxy)benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)c1cccc(OCC2CCCO2)c1 |
| InChI | InChI=1S/C24H30N2O6S/c1-30-23-11-10-21(33(28,29)26-12-3-2-4-13-26)16-22(23)25-24(27)18-7-5-8-19(15-18)32-17-20-9-6-14-31-20/h5,7-8,10-11,15-16,20H,2-4,6,9,12-14,17H2,1H3,(H,25,27) |
| InChIKey | BPRGAPQCEUDEOM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |