C19H29N3O4S2 — CID 8660108
1-[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 8660108) has the molecular formula C19H29N3O4S2 and a molecular weight of 427.59 g/mol. Its IUPAC name is 1-[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 8660108 |
| Molecular Formula | C19H29N3O4S2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCCC2)cc1NC(=S)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H29N3O4S2/c1-25-18-9-8-16(28(23,24)22-10-4-2-3-5-11-22)13-17(18)21-19(27)20-14-15-7-6-12-26-15/h8-9,13,15H,2-7,10-12,14H2,1H3,(H2,20,21,27)/t15-/m0/s1 |
| InChIKey | SDDKAGBKBNIGOC-HNNXBMFYSA-N |
| XLogP | 2.73 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|