C16H25N3O3S2 — CID 8659079
1-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-3-propan-2-ylthiourea (PubChem CID 8659079) has the molecular formula C16H25N3O3S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-3-propan-2-ylthiourea.
| Compound Name | 1-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 8659079 |
| Molecular Formula | C16H25N3O3S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-3-propan-2-ylthiourea |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=S)NC(C)C |
| InChI | InChI=1S/C16H25N3O3S2/c1-12(2)17-16(23)18-14-11-13(7-8-15(14)22-3)24(20,21)19-9-5-4-6-10-19/h7-8,11-12H,4-6,9-10H2,1-3H3,(H2,17,18,23) |
| InChIKey | FQZOEAZJXRXQOE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|