C21H24ClN3O5S2 — CID 133203564
3-(4-chlorophenyl)-3-[(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)carbamothioylamino]propanoic acid (PubChem CID 133203564) has the molecular formula C21H24ClN3O5S2 and a molecular weight of 498.03 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-[(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)carbamothioylamino]propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-3-[(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 133203564 |
| Molecular Formula | C21H24ClN3O5S2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 3-(4-chlorophenyl)-3-[(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)carbamothioylamino]propanoic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1NC(=S)NC(CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24ClN3O5S2/c1-30-19-9-8-16(32(28,29)25-10-2-3-11-25)12-18(19)24-21(31)23-17(13-20(26)27)14-4-6-15(22)7-5-14/h4-9,12,17H,2-3,10-11,13H2,1H3,(H,26,27)(H2,23,24,31) |
| InChIKey | IJJCPNLTEWKQJV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|