C23H28N2O7S — CID 55883959
methyl 2-[3-[[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]carbamoyl]phenoxy]acetate (PubChem CID 55883959) has the molecular formula C23H28N2O7S and a molecular weight of 476.55 g/mol. Its IUPAC name is methyl 2-[3-[[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]carbamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]carbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 55883959 |
| Molecular Formula | C23H28N2O7S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | methyl 2-[3-[[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]carbamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(C(=O)Nc2cc(S(=O)(=O)N3CCCCCC3)ccc2OC)c1 |
| InChI | InChI=1S/C23H28N2O7S/c1-30-21-11-10-19(33(28,29)25-12-5-3-4-6-13-25)15-20(21)24-23(27)17-8-7-9-18(14-17)32-16-22(26)31-2/h7-11,14-15H,3-6,12-13,16H2,1-2H3,(H,24,27) |
| InChIKey | MXGOQTLUZFEGPW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |