C25H33N3O6S2 — CID 4849595
N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-methyl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 4849595) has the molecular formula C25H33N3O6S2 and a molecular weight of 535.69 g/mol. Its IUPAC name is N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-methyl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-methyl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4849595 |
| Molecular Formula | C25H33N3O6S2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-methyl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)c1ccc(C)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C25H33N3O6S2/c1-19-9-10-20(17-24(19)36(32,33)28-15-7-4-8-16-28)25(29)26-22-18-21(11-12-23(22)34-2)35(30,31)27-13-5-3-6-14-27/h9-12,17-18H,3-8,13-16H2,1-2H3,(H,26,29) |
| InChIKey | VZGSQEGFNFEZGT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |