C28H33N3O6S2 — CID 4849587
3-[ethyl(phenyl)sulfamoyl]-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-methylbenzamide (PubChem CID 4849587) has the molecular formula C28H33N3O6S2 and a molecular weight of 571.72 g/mol. Its IUPAC name is 3-[ethyl(phenyl)sulfamoyl]-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-methylbenzamide.
| Compound Name | 3-[ethyl(phenyl)sulfamoyl]-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 4849587 |
| Molecular Formula | C28H33N3O6S2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 3-[ethyl(phenyl)sulfamoyl]-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-methylbenzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc(C(=O)Nc2cc(S(=O)(=O)N3CCCCC3)ccc2OC)ccc1C |
| InChI | InChI=1S/C28H33N3O6S2/c1-4-31(23-11-7-5-8-12-23)39(35,36)27-19-22(14-13-21(27)2)28(32)29-25-20-24(15-16-26(25)37-3)38(33,34)30-17-9-6-10-18-30/h5,7-8,11-16,19-20H,4,6,9-10,17-18H2,1-3H3,(H,29,32) |
| InChIKey | CMWKEEKJIMPCTN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |