C20H32N4O2S2 — CID 4836004
1-cyclohexyl-3-[2-(dimethylamino)-5-piperidin-1-ylsulfonylphenyl]thiourea (PubChem CID 4836004) has the molecular formula C20H32N4O2S2 and a molecular weight of 424.64 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(dimethylamino)-5-piperidin-1-ylsulfonylphenyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[2-(dimethylamino)-5-piperidin-1-ylsulfonylphenyl]thiourea |
|---|---|
| PubChem CID | 4836004 |
| Molecular Formula | C20H32N4O2S2 |
| Molecular Weight | 424.64 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1-cyclohexyl-3-[2-(dimethylamino)-5-piperidin-1-ylsulfonylphenyl]thiourea |
| SMILES | CN(C)c1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C20H32N4O2S2/c1-23(2)19-12-11-17(28(25,26)24-13-7-4-8-14-24)15-18(19)22-20(27)21-16-9-5-3-6-10-16/h11-12,15-16H,3-10,13-14H2,1-2H3,(H2,21,22,27) |
| InChIKey | GTHOLTIARPVJGI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.64 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|