C18H27N3O3S2 — CID 8659898
1-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea (PubChem CID 8659898) has the molecular formula C18H27N3O3S2 and a molecular weight of 397.57 g/mol. Its IUPAC name is 1-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8659898 |
| Molecular Formula | C18H27N3O3S2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 1-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@H]1CCCC[C@H]1NC(=S)Nc1cc(S(=O)(=O)N2CCCC2)ccc1O |
| InChI | InChI=1S/C18H27N3O3S2/c1-13-6-2-3-7-15(13)19-18(25)20-16-12-14(8-9-17(16)22)26(23,24)21-10-4-5-11-21/h8-9,12-13,15,22H,2-7,10-11H2,1H3,(H2,19,20,25)/t13-,15+/m0/s1 |
| InChIKey | ZGNNLMVTPRFNMA-DZGCQCFKSA-N |
| XLogP | 3.04 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|