C18H21N3O4S2 — CID 42993075
1-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-(3-methoxyphenyl)thiourea (PubChem CID 42993075) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 42993075 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 1-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)Nc2cc(S(=O)(=O)N3CCCC3)ccc2O)c1 |
| InChI | InChI=1S/C18H21N3O4S2/c1-25-14-6-4-5-13(11-14)19-18(26)20-16-12-15(7-8-17(16)22)27(23,24)21-9-2-3-10-21/h4-8,11-12,22H,2-3,9-10H2,1H3,(H2,19,20,26) |
| InChIKey | RPPBDQLEKUDTOR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|