C23H27N5O3S2 — CID 92657606
1-(3-methoxyphenyl)-3-[(E)-(1-methyl-5-piperidin-1-ylsulfonylindol-3-yl)methylideneamino]thiourea (PubChem CID 92657606) has the molecular formula C23H27N5O3S2 and a molecular weight of 485.64 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[(E)-(1-methyl-5-piperidin-1-ylsulfonylindol-3-yl)methylideneamino]thiourea.
| Compound Name | 1-(3-methoxyphenyl)-3-[(E)-(1-methyl-5-piperidin-1-ylsulfonylindol-3-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 92657606 |
| Molecular Formula | C23H27N5O3S2 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[(E)-(1-methyl-5-piperidin-1-ylsulfonylindol-3-yl)methylideneamino]thiourea |
| SMILES | COc1cccc(NC(=S)N/N=C/c2cn(C)c3ccc(S(=O)(=O)N4CCCCC4)cc23)c1 |
| InChI | InChI=1S/C23H27N5O3S2/c1-27-16-17(15-24-26-23(32)25-18-7-6-8-19(13-18)31-2)21-14-20(9-10-22(21)27)33(29,30)28-11-4-3-5-12-28/h6-10,13-16H,3-5,11-12H2,1-2H3,(H2,25,26,32)/b24-15+ |
| InChIKey | HBWGPURDCFVOND-BUVRLJJBSA-N |
| XLogP | 3.68 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|