C24H31N5O2S2 — CID 46251354
1-[(Z)-[5-(dipropylsulfamoyl)-1-methylindol-3-yl]methylideneamino]-3-(3-methylphenyl)thiourea (PubChem CID 46251354) has the molecular formula C24H31N5O2S2 and a molecular weight of 485.68 g/mol. Its IUPAC name is 1-[(Z)-[5-(dipropylsulfamoyl)-1-methylindol-3-yl]methylideneamino]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[(Z)-[5-(dipropylsulfamoyl)-1-methylindol-3-yl]methylideneamino]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 46251354 |
| Molecular Formula | C24H31N5O2S2 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 1-[(Z)-[5-(dipropylsulfamoyl)-1-methylindol-3-yl]methylideneamino]-3-(3-methylphenyl)thiourea |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc2c(c1)c(/C=N\NC(=S)Nc1cccc(C)c1)cn2C |
| InChI | InChI=1S/C24H31N5O2S2/c1-5-12-29(13-6-2)33(30,31)21-10-11-23-22(15-21)19(17-28(23)4)16-25-27-24(32)26-20-9-7-8-18(3)14-20/h7-11,14-17H,5-6,12-13H2,1-4H3,(H2,26,27,32)/b25-16- |
| InChIKey | BVQKSAFISSRGNX-XYGWBWBKSA-N |
| XLogP | 4.62 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|