C21H21ClFN5O2S2 — CID 4124127
1-(3-chloro-4-fluorophenyl)-3-[(5-piperidin-1-ylsulfonyl-1H-indol-3-yl)methylideneamino]thiourea (PubChem CID 4124127) has the molecular formula C21H21ClFN5O2S2 and a molecular weight of 494.02 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[(5-piperidin-1-ylsulfonyl-1H-indol-3-yl)methylideneamino]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[(5-piperidin-1-ylsulfonyl-1H-indol-3-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 4124127 |
| Molecular Formula | C21H21ClFN5O2S2 |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[(5-piperidin-1-ylsulfonyl-1H-indol-3-yl)methylideneamino]thiourea |
| SMILES | O=S(=O)(c1ccc2[nH]cc(C=NNC(=S)Nc3ccc(F)c(Cl)c3)c2c1)N1CCCCC1 |
| InChI | InChI=1S/C21H21ClFN5O2S2/c22-18-10-15(4-6-19(18)23)26-21(31)27-25-13-14-12-24-20-7-5-16(11-17(14)20)32(29,30)28-8-2-1-3-9-28/h4-7,10-13,24H,1-3,8-9H2,(H2,26,27,31) |
| InChIKey | GJOOVAIKRQFOGR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|