C23H27N5O2S2 — CID 135886662
1-(4-ethylphenyl)-3-[(E)-(5-piperidin-1-ylsulfonyl-1H-indol-3-yl)methylideneamino]thiourea (PubChem CID 135886662) has the molecular formula C23H27N5O2S2 and a molecular weight of 469.64 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[(E)-(5-piperidin-1-ylsulfonyl-1H-indol-3-yl)methylideneamino]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[(E)-(5-piperidin-1-ylsulfonyl-1H-indol-3-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135886662 |
| Molecular Formula | C23H27N5O2S2 |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[(E)-(5-piperidin-1-ylsulfonyl-1H-indol-3-yl)methylideneamino]thiourea |
| SMILES | CCc1ccc(NC(=S)N/N=C/c2c[nH]c3ccc(S(=O)(=O)N4CCCCC4)cc23)cc1 |
| InChI | InChI=1S/C23H27N5O2S2/c1-2-17-6-8-19(9-7-17)26-23(31)27-25-16-18-15-24-22-11-10-20(14-21(18)22)32(29,30)28-12-4-3-5-13-28/h6-11,14-16,24H,2-5,12-13H2,1H3,(H2,26,27,31)/b25-16+ |
| InChIKey | QCJZYEDBEQEKDT-PCLIKHOPSA-N |
| XLogP | 4.23 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|