C22H25N5O2S2 — CID 136680594
1-(2-methylphenyl)-3-[(Z)-(5-piperidin-1-ylsulfonyl-1H-indol-3-yl)methylideneamino]thiourea (PubChem CID 136680594) has the molecular formula C22H25N5O2S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[(Z)-(5-piperidin-1-ylsulfonyl-1H-indol-3-yl)methylideneamino]thiourea.
| Compound Name | 1-(2-methylphenyl)-3-[(Z)-(5-piperidin-1-ylsulfonyl-1H-indol-3-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 136680594 |
| Molecular Formula | C22H25N5O2S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 1-(2-methylphenyl)-3-[(Z)-(5-piperidin-1-ylsulfonyl-1H-indol-3-yl)methylideneamino]thiourea |
| SMILES | Cc1ccccc1NC(=S)N/N=C\c1c[nH]c2ccc(S(=O)(=O)N3CCCCC3)cc12 |
| InChI | InChI=1S/C22H25N5O2S2/c1-16-7-3-4-8-20(16)25-22(30)26-24-15-17-14-23-21-10-9-18(13-19(17)21)31(28,29)27-11-5-2-6-12-27/h3-4,7-10,13-15,23H,2,5-6,11-12H2,1H3,(H2,25,26,30)/b24-15- |
| InChIKey | YHJDAQREFKAHPQ-IWIPYMOSSA-N |
| XLogP | 3.97 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|