C20H20BrN5O3S2 — CID 136773543
1-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 136773543) has the molecular formula C20H20BrN5O3S2 and a molecular weight of 522.45 g/mol. Its IUPAC name is 1-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 136773543 |
| Molecular Formula | C20H20BrN5O3S2 |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 521.02 |
| IUPAC Name | 1-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | O=S(=O)(c1ccc(NC(=S)N/N=C\c2c[nH]c3ccc(Br)cc23)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H20BrN5O3S2/c21-15-1-6-19-18(11-15)14(12-22-19)13-23-25-20(30)24-16-2-4-17(5-3-16)31(27,28)26-7-9-29-10-8-26/h1-6,11-13,22H,7-10H2,(H2,24,25,30)/b23-13- |
| InChIKey | YWMWXUDBIBZQGG-QRVIBDJDSA-N |
| XLogP | 3.27 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|