C20H22N4O5S2 — CID 4579397
1-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 4579397) has the molecular formula C20H22N4O5S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 4579397 |
| Molecular Formula | C20H22N4O5S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | O=S(=O)(c1ccc(NC(=S)NN=Cc2ccc3c(c2)OCCO3)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H22N4O5S2/c25-31(26,24-7-9-27-10-8-24)17-4-2-16(3-5-17)22-20(30)23-21-14-15-1-6-18-19(13-15)29-12-11-28-18/h1-6,13-14H,7-12H2,(H2,22,23,30) |
| InChIKey | GHTKVYJBSSNETF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|