C24H24N4O6S3 — CID 3509809
[2-methoxy-4-[[(4-morpholin-4-ylsulfonylphenyl)carbamothioylhydrazinylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 3509809) has the molecular formula C24H24N4O6S3 and a molecular weight of 560.68 g/mol. Its IUPAC name is [2-methoxy-4-[[(4-morpholin-4-ylsulfonylphenyl)carbamothioylhydrazinylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [2-methoxy-4-[[(4-morpholin-4-ylsulfonylphenyl)carbamothioylhydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3509809 |
| Molecular Formula | C24H24N4O6S3 |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | [2-methoxy-4-[[(4-morpholin-4-ylsulfonylphenyl)carbamothioylhydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(C=NNC(=S)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C24H24N4O6S3/c1-32-21-15-17(4-9-20(21)34-23(29)22-3-2-14-36-22)16-25-27-24(35)26-18-5-7-19(8-6-18)37(30,31)28-10-12-33-13-11-28/h2-9,14-16H,10-13H2,1H3,(H2,26,27,35) |
| InChIKey | BEULBXHRFIOKHB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|