C21H23F2N3O7S — CID 42967732
2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-(4-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 42967732) has the molecular formula C21H23F2N3O7S and a molecular weight of 499.49 g/mol. Its IUPAC name is 2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-(4-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-(4-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 42967732 |
| Molecular Formula | C21H23F2N3O7S |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 2-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxy-N-(4-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | COc1cc(/C=N/OCC(=O)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C21H23F2N3O7S/c1-30-19-12-15(2-7-18(19)33-21(22)23)13-24-32-14-20(27)25-16-3-5-17(6-4-16)34(28,29)26-8-10-31-11-9-26/h2-7,12-13,21H,8-11,14H2,1H3,(H,25,27)/b24-13+ |
| InChIKey | WPIUJIWXWPYIMD-ZMOGYAJESA-N |
| XLogP | 2.31 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|