C22H22F2N2O7S — CID 42003989
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 42003989) has the molecular formula C22H22F2N2O7S and a molecular weight of 496.49 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 42003989 |
| Molecular Formula | C22H22F2N2O7S |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H22F2N2O7S/c23-22(24)33-18-6-4-17(5-7-18)25-20(27)15-32-21(28)10-3-16-1-8-19(9-2-16)34(29,30)26-11-13-31-14-12-26/h1-10,22H,11-15H2,(H,25,27)/b10-3+ |
| InChIKey | PKSGKRMTGBRWGA-XCVCLJGOSA-N |
| XLogP | 2.50 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|