C19H14F5NO5 — CID 31975754
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate (PubChem CID 31975754) has the molecular formula C19H14F5NO5 and a molecular weight of 431.31 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 31975754 |
| Molecular Formula | C19H14F5NO5 |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(OC(F)(F)F)cc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H14F5NO5/c20-18(21)29-14-8-4-13(5-9-14)25-16(26)11-28-17(27)10-3-12-1-6-15(7-2-12)30-19(22,23)24/h1-10,18H,11H2,(H,25,26)/b10-3+ |
| InChIKey | LEALCUXYZFAUAL-XCVCLJGOSA-N |
| XLogP | 4.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|