C22H21F3N2O6 — CID 55326763
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate (PubChem CID 55326763) has the molecular formula C22H21F3N2O6 and a molecular weight of 466.41 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate |
|---|---|
| PubChem CID | 55326763 |
| Molecular Formula | C22H21F3N2O6 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate |
| SMILES | COc1ccc(C=CC(=O)NC(C)C(=O)OCC(=O)Nc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H21F3N2O6/c1-14(26-19(28)12-5-15-3-8-17(31-2)9-4-15)21(30)32-13-20(29)27-16-6-10-18(11-7-16)33-22(23,24)25/h3-12,14H,13H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | UGOMTGFLCRVQBS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|