C21H21N3O5 — CID 8939992
[2-(4-carbamoylanilino)-2-oxoethyl] (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoate (PubChem CID 8939992) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 8939992 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)/C=C/c1ccccc1)C(=O)OCC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C21H21N3O5/c1-14(23-18(25)12-7-15-5-3-2-4-6-15)21(28)29-13-19(26)24-17-10-8-16(9-11-17)20(22)27/h2-12,14H,13H2,1H3,(H2,22,27)(H,23,25)(H,24,26)/b12-7+/t14-/m0/s1 |
| InChIKey | HEYHOWLJZAGDRI-GMMCIKNFSA-N |
| XLogP | 1.49 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|