C23H25N3O5 — CID 8940116
[(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoate (PubChem CID 8940116) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoate.
| Compound Name | [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 8940116 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@@H](C)OC(=O)[C@H](C)NC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N3O5/c1-15(24-21(28)14-9-18-7-5-4-6-8-18)23(30)31-16(2)22(29)26-20-12-10-19(11-13-20)25-17(3)27/h4-16H,1-3H3,(H,24,28)(H,25,27)(H,26,29)/b14-9+/t15-,16+/m0/s1 |
| InChIKey | OJXAHHQEQUSASI-IYSULOHHSA-N |
| XLogP | 2.73 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|